C22H38O5Si — CID 59566124
methyl (2E)-2-[(2S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate (PubChem CID 59566124) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 59566124 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl (2E)-2-[(2S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-3-oxo-6-prop-2-enyloxan-4-ylidene]acetate |
| SMILES | C=CC[C@@H]1C/C(=C\C(=O)OC)C(=O)[C@](C)(C(C)(C)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H38O5Si/c1-11-12-17-13-16(14-18(23)25-8)19(24)22(7,27-17)21(5,6)15-26-28(9,10)20(2,3)4/h11,14,17H,1,12-13,15H2,2-10H3/b16-14+/t17-,22-/m1/s1 |
| InChIKey | WJIZIYIIHSIEPU-OKKOFRBBSA-N |
| XLogP | 4.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|