C23H31NO2 — CID 59566333
5-tert-butyl-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 59566333) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-tert-butyl-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-tert-butyl-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 59566333 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 5-tert-butyl-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC(C)(C)c1cc2cc3c4c(c2oc1=O)C(C)(C)CCN4CCC3(C)C |
| InChI | InChI=1S/C23H31NO2/c1-21(2,3)16-13-14-12-15-18-17(19(14)26-20(16)25)23(6,7)9-11-24(18)10-8-22(15,4)5/h12-13H,8-11H2,1-7H3 |
| InChIKey | DWYOTLGMGGEMGG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|