About 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine
4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine (PubChem CID 59566476) has the molecular formula C10H13ClFN3O
and a molecular weight of 245.68 g/mol. Its IUPAC name is 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine |
| PubChem CID | 59566476 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine |
| SMILES | Cc1c(Cl)ncnc1O[C@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C10H13ClFN3O/c1-6-9(11)14-5-15-10(6)16-8-2-3-13-4-7(8)12/h5,7-8,13H,2-4H2,1H3/t7-,8+/m1/s1 |
| InChIKey | FFIGHYQRDVMAMV-SFYZADRCSA-N |
| XLogP | 1.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine?
The IUPAC name of 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine (CID 59566476) is 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine.
What is the SMILES notation for 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine?
The canonical SMILES for 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine is Cc1c(Cl)ncnc1O[C@H]1CCNC[C@H]1F.
What is the InChIKey of 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine?
The InChIKey is FFIGHYQRDVMAMV-SFYZADRCSA-N. The full InChI is InChI=1S/C10H13ClFN3O/c1-6-9(11)14-5-15-10(6)16-8-2-3-13-4-7(8)12/h5,7-8,13H,2-4H2,1H3/t7-,8+/m1/s1.
What are the key properties of 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine?
4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine has a molecular weight of 245.68 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-methylpyrimidine is sourced from PubChem (CID 59566476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).