About (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate
(1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate (PubChem CID 59566516) has the molecular formula C14H17ClFN3O3
and a molecular weight of 329.76 g/mol. Its IUPAC name is (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate |
| PubChem CID | 59566516 |
| Molecular Formula | C14H17ClFN3O3 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate |
| SMILES | CC1(OC(=O)N2CC[C@H](Oc3cc(Cl)ncn3)[C@H](F)C2)CC1 |
| InChI | InChI=1S/C14H17ClFN3O3/c1-14(3-4-14)22-13(20)19-5-2-10(9(16)7-19)21-12-6-11(15)17-8-18-12/h6,8-10H,2-5,7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | WZDNCHUMYTVOML-ZJUUUORDSA-N |
| XLogP | 2.61 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The IUPAC name of (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate (CID 59566516) is (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate.
What is the SMILES notation for (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The canonical SMILES for (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate is CC1(OC(=O)N2CC[C@H](Oc3cc(Cl)ncn3)[C@H](F)C2)CC1.
What is the InChIKey of (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The InChIKey is WZDNCHUMYTVOML-ZJUUUORDSA-N. The full InChI is InChI=1S/C14H17ClFN3O3/c1-14(3-4-14)22-13(20)19-5-2-10(9(16)7-19)21-12-6-11(15)17-8-18-12/h6,8-10H,2-5,7H2,1H3/t9-,10+/m1/s1.
What are the key properties of (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
(1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate has a molecular weight of 329.76 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) (3R,4S)-4-(6-chloropyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 59566516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).