C13H20O7 — CID 59566581
[6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 2,2-dimethylbutanoate (PubChem CID 59566581) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is [6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 2,2-dimethylbutanoate.
| Compound Name | [6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59566581 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1OC(CO)C2OC(=O)OC12 |
| InChI | InChI=1S/C13H20O7/c1-4-13(2,3)11(15)17-6-8-10-9(7(5-14)18-8)19-12(16)20-10/h7-10,14H,4-6H2,1-3H3 |
| InChIKey | SULQCDCXPJCVCT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |