About triethoxy-(4-methoxy-3,5-dimethylphenyl)silane
triethoxy-(4-methoxy-3,5-dimethylphenyl)silane (PubChem CID 59566872) has the molecular formula C15H26O4Si
and a molecular weight of 298.45 g/mol. Its IUPAC name is triethoxy-(4-methoxy-3,5-dimethylphenyl)silane.
Molecular Properties
| Compound Name | triethoxy-(4-methoxy-3,5-dimethylphenyl)silane |
| PubChem CID | 59566872 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | triethoxy-(4-methoxy-3,5-dimethylphenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C15H26O4Si/c1-7-17-20(18-8-2,19-9-3)14-10-12(4)15(16-6)13(5)11-14/h10-11H,7-9H2,1-6H3 |
| InChIKey | LQZGIJSVBHTMTB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-(4-methoxy-3,5-dimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-(4-methoxy-3,5-dimethylphenyl)silane?
The IUPAC name of triethoxy-(4-methoxy-3,5-dimethylphenyl)silane (CID 59566872) is triethoxy-(4-methoxy-3,5-dimethylphenyl)silane.
What is the SMILES notation for triethoxy-(4-methoxy-3,5-dimethylphenyl)silane?
The canonical SMILES for triethoxy-(4-methoxy-3,5-dimethylphenyl)silane is CCO[Si](OCC)(OCC)c1cc(C)c(OC)c(C)c1.
What is the InChIKey of triethoxy-(4-methoxy-3,5-dimethylphenyl)silane?
The InChIKey is LQZGIJSVBHTMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O4Si/c1-7-17-20(18-8-2,19-9-3)14-10-12(4)15(16-6)13(5)11-14/h10-11H,7-9H2,1-6H3.
What are the key properties of triethoxy-(4-methoxy-3,5-dimethylphenyl)silane?
triethoxy-(4-methoxy-3,5-dimethylphenyl)silane has a molecular weight of 298.45 g/mol, XLogP of 2.57, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-(4-methoxy-3,5-dimethylphenyl)silane is sourced from PubChem (CID 59566872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).