About 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium
3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium (PubChem CID 59567259) has the molecular formula C8H10NO3SY-
and a molecular weight of 289.15 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium.
Molecular Properties
| Compound Name | 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium |
| PubChem CID | 59567259 |
| Molecular Formula | C8H10NO3SY- |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium |
| SMILES | CCSC1CC(=O)N(C[C-]=O)C1=O.[Y] |
| InChI | InChI=1S/C8H10NO3S.Y/c1-2-13-6-5-7(11)9(3-4-10)8(6)12;/h6H,2-3,5H2,1H3;/q-1; |
| InChIKey | WVIPOPAJIZAWMG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium?
The IUPAC name of 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium (CID 59567259) is 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium.
What is the SMILES notation for 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium?
The canonical SMILES for 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium is CCSC1CC(=O)N(C[C-]=O)C1=O.[Y].
What is the InChIKey of 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium?
The InChIKey is WVIPOPAJIZAWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO3S.Y/c1-2-13-6-5-7(11)9(3-4-10)8(6)12;/h6H,2-3,5H2,1H3;/q-1;.
What are the key properties of 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium?
3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium has a molecular weight of 289.15 g/mol, XLogP of -0.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-1-(2-oxoethyl)pyrrolidine-2,5-dione;yttrium is sourced from PubChem (CID 59567259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).