About 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide
6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide (PubChem CID 59568543) has the molecular formula C19H25N3O4
and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide |
| PubChem CID | 59568543 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide |
| SMILES | CCCCc1noc(C)c1COc1ccc(C(=O)N[C@H]2CCOC2)cn1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-4-5-17-16(13(2)26-22-17)12-25-18-7-6-14(10-20-18)19(23)21-15-8-9-24-11-15/h6-7,10,15H,3-5,8-9,11-12H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | UJNVUMDMUNHYFT-HNNXBMFYSA-N |
| XLogP | 2.82 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide?
The IUPAC name of 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide (CID 59568543) is 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide.
What is the SMILES notation for 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide?
The canonical SMILES for 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide is CCCCc1noc(C)c1COc1ccc(C(=O)N[C@H]2CCOC2)cn1.
What is the InChIKey of 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide?
The InChIKey is UJNVUMDMUNHYFT-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H25N3O4/c1-3-4-5-17-16(13(2)26-22-17)12-25-18-7-6-14(10-20-18)19(23)21-15-8-9-24-11-15/h6-7,10,15H,3-5,8-9,11-12H2,1-2H3,(H,21,23)/t15-/m0/s1.
What are the key properties of 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide?
6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide has a molecular weight of 359.43 g/mol, XLogP of 2.82, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-butyl-5-methyl-1,2-oxazol-4-yl)methoxy]-N-[(3S)-oxolan-3-yl]pyridine-3-carboxamide is sourced from PubChem (CID 59568543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).