About 3,5-dimethyl-1,3-benzothiazol-2-one
3,5-dimethyl-1,3-benzothiazol-2-one (PubChem CID 59568555) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3-benzothiazol-2-one |
| PubChem CID | 59568555 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3,5-dimethyl-1,3-benzothiazol-2-one |
| SMILES | Cc1ccc2sc(=O)n(C)c2c1 |
| InChI | InChI=1S/C9H9NOS/c1-6-3-4-8-7(5-6)10(2)9(11)12-8/h3-5H,1-2H3 |
| InChIKey | YSQZVDXBRUBKHF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3-benzothiazol-2-one?
The IUPAC name of 3,5-dimethyl-1,3-benzothiazol-2-one (CID 59568555) is 3,5-dimethyl-1,3-benzothiazol-2-one.
What is the SMILES notation for 3,5-dimethyl-1,3-benzothiazol-2-one?
The canonical SMILES for 3,5-dimethyl-1,3-benzothiazol-2-one is Cc1ccc2sc(=O)n(C)c2c1.
What is the InChIKey of 3,5-dimethyl-1,3-benzothiazol-2-one?
The InChIKey is YSQZVDXBRUBKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-6-3-4-8-7(5-6)10(2)9(11)12-8/h3-5H,1-2H3.
What are the key properties of 3,5-dimethyl-1,3-benzothiazol-2-one?
3,5-dimethyl-1,3-benzothiazol-2-one has a molecular weight of 179.24 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3-benzothiazol-2-one is sourced from PubChem (CID 59568555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).