C27H28FNO3 — CID 59568784
(E,2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6,6-diphenylhex-4-enamide (PubChem CID 59568784) has the molecular formula C27H28FNO3 and a molecular weight of 433.52 g/mol. Its IUPAC name is (E,2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6,6-diphenylhex-4-enamide.
| Compound Name | (E,2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6,6-diphenylhex-4-enamide |
|---|---|
| PubChem CID | 59568784 |
| Molecular Formula | C27H28FNO3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (E,2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6,6-diphenylhex-4-enamide |
| SMILES | CO[C@H](C[C@H](C/C=C/C(c1ccccc1)c1ccccc1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FNO3/c1-32-26(22-15-17-24(28)18-16-22)19-23(27(30)29-31)13-8-14-25(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-12,14-18,23,25-26,31H,13,19H2,1H3,(H,29,30)/b14-8+/t23-,26+/m0/s1 |
| InChIKey | JYYOYMJQYVRMJJ-DDINODHBSA-N |
| XLogP | 5.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|