C18H19N5O2S — CID 59569006
3-(3-aminopropyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one (PubChem CID 59569006) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 3-(3-aminopropyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 3-(3-aminopropyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 59569006 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-(3-aminopropyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
| SMILES | Cn1c(-c2ccco2)nc2cc(C3=NN(CCCN)C(=O)SC3)ccc21 |
| InChI | InChI=1S/C18H19N5O2S/c1-22-15-6-5-12(10-13(15)20-17(22)16-4-2-9-25-16)14-11-26-18(24)23(21-14)8-3-7-19/h2,4-6,9-10H,3,7-8,11,19H2,1H3 |
| InChIKey | UMWLYPSHOCDWJA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|