C22H24N4O2S — CID 59569015
3-(cyclohexylmethyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one (PubChem CID 59569015) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 3-(cyclohexylmethyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 59569015 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-(cyclohexylmethyl)-5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
| SMILES | Cn1c(-c2ccco2)nc2cc(C3=NN(CC4CCCCC4)C(=O)SC3)ccc21 |
| InChI | InChI=1S/C22H24N4O2S/c1-25-19-10-9-16(12-17(19)23-21(25)20-8-5-11-28-20)18-14-29-22(27)26(24-18)13-15-6-3-2-4-7-15/h5,8-12,15H,2-4,6-7,13-14H2,1H3 |
| InChIKey | UAENZOSDNHSBRJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 63.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|