C19H18N4O2S — CID 59569049
5-[2-(2-methoxyphenyl)-1-methylbenzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 59569049) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 5-[2-(2-methoxyphenyl)-1-methylbenzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 5-[2-(2-methoxyphenyl)-1-methylbenzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 59569049 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-[2-(2-methoxyphenyl)-1-methylbenzimidazol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | COc1ccccc1-c1nc2cc(C3=NNC(=O)SC3C)ccc2n1C |
| InChI | InChI=1S/C19H18N4O2S/c1-11-17(21-22-19(24)26-11)12-8-9-15-14(10-12)20-18(23(15)2)13-6-4-5-7-16(13)25-3/h4-11H,1-3H3,(H,22,24) |
| InChIKey | KNKIPBNOMDGUIB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|