C21H25N5O4S2 — CID 59569054
N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]butane-1-sulfonamide (PubChem CID 59569054) has the molecular formula C21H25N5O4S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 59569054 |
| Molecular Formula | C21H25N5O4S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[2-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCN1N=C(c2ccc3c(c2)nc(-c2ccco2)n3C)CSC1=O |
| InChI | InChI=1S/C21H25N5O4S2/c1-3-4-12-32(28,29)22-9-10-26-21(27)31-14-17(24-26)15-7-8-18-16(13-15)23-20(25(18)2)19-6-5-11-30-19/h5-8,11,13,22H,3-4,9-10,12,14H2,1-2H3 |
| InChIKey | NJGFNOHTVLMKEO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|