C25H23ClN6O3S — CID 59569062
1-(4-chlorophenyl)-3-[3-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]urea (PubChem CID 59569062) has the molecular formula C25H23ClN6O3S and a molecular weight of 523.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]urea |
|---|---|
| PubChem CID | 59569062 |
| Molecular Formula | C25H23ClN6O3S |
| Molecular Weight | 523.02 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-[5-[2-(furan-2-yl)-1-methylbenzimidazol-5-yl]-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]urea |
| SMILES | Cn1c(-c2ccco2)nc2cc(C3=NN(CCCNC(=O)Nc4ccc(Cl)cc4)C(=O)SC3)ccc21 |
| InChI | InChI=1S/C25H23ClN6O3S/c1-31-21-10-5-16(14-19(21)29-23(31)22-4-2-13-35-22)20-15-36-25(34)32(30-20)12-3-11-27-24(33)28-18-8-6-17(26)7-9-18/h2,4-10,13-14H,3,11-12,15H2,1H3,(H2,27,28,33) |
| InChIKey | MKWKJKGUSYFGRH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.02 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|