C12H22N2S — CID 59569175
N,N-diethyl-4-(3-methylbutyl)-1,3-thiazol-2-amine (PubChem CID 59569175) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N,N-diethyl-4-(3-methylbutyl)-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-4-(3-methylbutyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 59569175 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N,N-diethyl-4-(3-methylbutyl)-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1nc(CCC(C)C)cs1 |
| InChI | InChI=1S/C12H22N2S/c1-5-14(6-2)12-13-11(9-15-12)8-7-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | MHRZJQWRSCZYLP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |