About N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide
N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide (PubChem CID 59569606) has the molecular formula C9H10F2N2O3S
and a molecular weight of 264.25 g/mol. Its IUPAC name is N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide |
| PubChem CID | 59569606 |
| Molecular Formula | C9H10F2N2O3S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ncc(F)c(C=O)c1F |
| InChI | InChI=1S/C9H10F2N2O3S/c1-2-3-17(15,16)13-9-8(11)6(5-14)7(10)4-12-9/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | AECCXBFBDNXKGT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide?
The IUPAC name of N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide (CID 59569606) is N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide.
What is the SMILES notation for N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide?
The canonical SMILES for N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide is CCCS(=O)(=O)Nc1ncc(F)c(C=O)c1F.
What is the InChIKey of N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide?
The InChIKey is AECCXBFBDNXKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O3S/c1-2-3-17(15,16)13-9-8(11)6(5-14)7(10)4-12-9/h4-5H,2-3H2,1H3,(H,12,13).
What are the key properties of N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide?
N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide has a molecular weight of 264.25 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-difluoro-4-formyl-2-pyridinyl)propane-1-sulfonamide is sourced from PubChem (CID 59569606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).