C27H44N2O7 — CID 59571140
(1S,4R,6R,14R,18R)-14-(2-hexoxy-2-oxoethyl)-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid (PubChem CID 59571140) has the molecular formula C27H44N2O7 and a molecular weight of 508.66 g/mol. Its IUPAC name is (1S,4R,6R,14R,18R)-14-(2-hexoxy-2-oxoethyl)-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid.
| Compound Name | (1S,4R,6R,14R,18R)-14-(2-hexoxy-2-oxoethyl)-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid |
|---|---|
| PubChem CID | 59571140 |
| Molecular Formula | C27H44N2O7 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | (1S,4R,6R,14R,18R)-14-(2-hexoxy-2-oxoethyl)-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid |
| SMILES | CCCCCCOC(=O)C[C@H]1CCCCCCC[C@@H]2C[C@@]2(C(=O)O)NC(=O)[C@@H]2C[C@@H](OC)CN2C1=O |
| InChI | InChI=1S/C27H44N2O7/c1-3-4-5-11-14-36-23(30)15-19-12-9-7-6-8-10-13-20-17-27(20,26(33)34)28-24(31)22-16-21(35-2)18-29(22)25(19)32/h19-22H,3-18H2,1-2H3,(H,28,31)(H,33,34)/t19-,20-,21-,22+,27-/m1/s1 |
| InChIKey | DCOBNIJPRGFDKU-MCAIBZCSSA-N |
| XLogP | 3.44 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|