C28H46N2O7 — CID 59571268
(1S,4R,6S,15R,19R)-15-(2-hexoxy-2-oxoethyl)-19-methoxy-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylic acid (PubChem CID 59571268) has the molecular formula C28H46N2O7 and a molecular weight of 522.68 g/mol. Its IUPAC name is (1S,4R,6S,15R,19R)-15-(2-hexoxy-2-oxoethyl)-19-methoxy-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylic acid.
| Compound Name | (1S,4R,6S,15R,19R)-15-(2-hexoxy-2-oxoethyl)-19-methoxy-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylic acid |
|---|---|
| PubChem CID | 59571268 |
| Molecular Formula | C28H46N2O7 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | (1S,4R,6S,15R,19R)-15-(2-hexoxy-2-oxoethyl)-19-methoxy-2,16-dioxo-3,17-diazatricyclo[15.3.0.04,6]icosane-4-carboxylic acid |
| SMILES | CCCCCCOC(=O)C[C@H]1CCCCCCCC[C@H]2C[C@@]2(C(=O)O)NC(=O)[C@@H]2C[C@@H](OC)CN2C1=O |
| InChI | InChI=1S/C28H46N2O7/c1-3-4-5-12-15-37-24(31)16-20-13-10-8-6-7-9-11-14-21-18-28(21,27(34)35)29-25(32)23-17-22(36-2)19-30(23)26(20)33/h20-23H,3-19H2,1-2H3,(H,29,32)(H,34,35)/t20-,21+,22-,23+,28-/m1/s1 |
| InChIKey | NGRYHLREZNXLNE-OFRDVNMMSA-N |
| XLogP | 3.83 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|