C27H34N2O7 — CID 59571298
2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 59571298) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59571298 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](OC(=O)CCC(=O)NC(C(=O)O)C(C)C)C=CC4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C27H34N2O7/c1-14(2)23(26(32)33)28-20(30)9-10-21(31)35-19-8-6-16-17-13-15-5-7-18(34-4)24-22(15)27(16,25(19)36-24)11-12-29(17)3/h5-8,14,16-17,19,23,25H,9-13H2,1-4H3,(H,28,30)(H,32,33)/t16?,17-,19+,23?,25+,27+/m1/s1 |
| InChIKey | ONPNODZOERNJCB-SZMAEQJJSA-N |
| XLogP | 2.06 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|