C29H37N3O8 — CID 59571347
2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-acetamido-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 59571347) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-acetamido-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-acetamido-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59571347 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 2-[[4-[[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-acetamido-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](OC(=O)CC(NC(C)=O)C(=O)NC(C(=O)O)C(C)C)C=CC4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C29H37N3O8/c1-14(2)24(28(36)37)31-27(35)18(30-15(3)33)13-22(34)39-21-9-7-17-19-12-16-6-8-20(38-5)25-23(16)29(17,26(21)40-25)10-11-32(19)4/h6-9,14,17-19,21,24,26H,10-13H2,1-5H3,(H,30,33)(H,31,35)(H,36,37)/t17?,18?,19-,21+,24?,26+,29+/m1/s1 |
| InChIKey | KZSKXSCAARZDNP-JGBCBKTBSA-N |
| XLogP | 1.17 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|