C32H27F2N3O4 — CID 59571993
5-amino-1-N,3-N-bis[3-fluoro-5-[2-(oxolan-3-yl)ethynyl]phenyl]benzene-1,3-dicarboxamide (PubChem CID 59571993) has the molecular formula C32H27F2N3O4 and a molecular weight of 555.58 g/mol. Its IUPAC name is 5-amino-1-N,3-N-bis[3-fluoro-5-[2-(oxolan-3-yl)ethynyl]phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-amino-1-N,3-N-bis[3-fluoro-5-[2-(oxolan-3-yl)ethynyl]phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59571993 |
| Molecular Formula | C32H27F2N3O4 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 5-amino-1-N,3-N-bis[3-fluoro-5-[2-(oxolan-3-yl)ethynyl]phenyl]benzene-1,3-dicarboxamide |
| SMILES | Nc1cc(C(=O)Nc2cc(F)cc(C#CC3CCOC3)c2)cc(C(=O)Nc2cc(F)cc(C#CC3CCOC3)c2)c1 |
| InChI | InChI=1S/C32H27F2N3O4/c33-26-9-22(3-1-20-5-7-40-18-20)11-29(16-26)36-31(38)24-13-25(15-28(35)14-24)32(39)37-30-12-23(10-27(34)17-30)4-2-21-6-8-41-19-21/h9-17,20-21H,5-8,18-19,35H2,(H,36,38)(H,37,39) |
| InChIKey | PNERXUZKJLAZSQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|