About 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide
6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide (PubChem CID 59572267) has the molecular formula C22H17NO3S
and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide.
Molecular Properties
| Compound Name | 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide |
| PubChem CID | 59572267 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide |
| SMILES | COc1cc(C)ccc1N1c2ccccc2S(=O)c2c1oc1ccccc21 |
| InChI | InChI=1S/C22H17NO3S/c1-14-11-12-16(19(13-14)25-2)23-17-8-4-6-10-20(17)27(24)21-15-7-3-5-9-18(15)26-22(21)23/h3-13H,1-2H3 |
| InChIKey | PDDGXNPKWOALJW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide?
The IUPAC name of 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide (CID 59572267) is 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide.
What is the SMILES notation for 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide?
The canonical SMILES for 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide is COc1cc(C)ccc1N1c2ccccc2S(=O)c2c1oc1ccccc21.
What is the InChIKey of 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide?
The InChIKey is PDDGXNPKWOALJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO3S/c1-14-11-12-16(19(13-14)25-2)23-17-8-4-6-10-20(17)27(24)21-15-7-3-5-9-18(15)26-22(21)23/h3-13H,1-2H3.
What are the key properties of 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide?
6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide has a molecular weight of 375.45 g/mol, XLogP of 5.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxy-4-methylphenyl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide is sourced from PubChem (CID 59572267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).