C25H21NO3S — CID 59572293
6-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide (PubChem CID 59572293) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is 6-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide.
| Compound Name | 6-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide |
|---|---|
| PubChem CID | 59572293 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 6-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide |
| SMILES | Cc1ccc(N2c3ccccc3S(=O)(=O)c3c2oc2ccccc32)c2c1CCCC2 |
| InChI | InChI=1S/C25H21NO3S/c1-16-14-15-20(18-9-3-2-8-17(16)18)26-21-11-5-7-13-23(21)30(27,28)24-19-10-4-6-12-22(19)29-25(24)26/h4-7,10-15H,2-3,8-9H2,1H3 |
| InChIKey | BFUGBAYCDUSZBZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |