About 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine
2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine (PubChem CID 59572530) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine.
Molecular Properties
| Compound Name | 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine |
| PubChem CID | 59572530 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine |
| SMILES | Cc1cc2c(o1)N(c1ccccc1-c1ccccc1)c1ccccc1N=N2 |
| InChI | InChI=1S/C23H17N3O/c1-16-15-20-23(27-16)26(22-14-8-6-12-19(22)24-25-20)21-13-7-5-11-18(21)17-9-3-2-4-10-17/h2-15H,1H3 |
| InChIKey | KEGDPXAXNQDFEJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 41.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine?
The IUPAC name of 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine (CID 59572530) is 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine.
What is the SMILES notation for 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine?
The canonical SMILES for 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine is Cc1cc2c(o1)N(c1ccccc1-c1ccccc1)c1ccccc1N=N2.
What is the InChIKey of 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine?
The InChIKey is KEGDPXAXNQDFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c1-16-15-20-23(27-16)26(22-14-8-6-12-19(22)24-25-20)21-13-7-5-11-18(21)17-9-3-2-4-10-17/h2-15H,1H3.
What are the key properties of 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine?
2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine has a molecular weight of 351.41 g/mol, XLogP of 7.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-10-(2-phenylphenyl)furo[3,2-c][1,2,5]benzotriazepine is sourced from PubChem (CID 59572530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).