About 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide
9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide (PubChem CID 59572577) has the molecular formula C18H15NO2S
and a molecular weight of 309.39 g/mol. Its IUPAC name is 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide.
Molecular Properties
| Compound Name | 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide |
| PubChem CID | 59572577 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide |
| SMILES | Cc1ccc(N2c3ccccc3S(=O)c3ccoc32)c(C)c1 |
| InChI | InChI=1S/C18H15NO2S/c1-12-7-8-14(13(2)11-12)19-15-5-3-4-6-16(15)22(20)17-9-10-21-18(17)19/h3-11H,1-2H3 |
| InChIKey | XAMQLSUPRIPNAY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide?
The IUPAC name of 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide (CID 59572577) is 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide.
What is the SMILES notation for 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide?
The canonical SMILES for 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide is Cc1ccc(N2c3ccccc3S(=O)c3ccoc32)c(C)c1.
What is the InChIKey of 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide?
The InChIKey is XAMQLSUPRIPNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2S/c1-12-7-8-14(13(2)11-12)19-15-5-3-4-6-16(15)22(20)17-9-10-21-18(17)19/h3-11H,1-2H3.
What are the key properties of 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide?
9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide has a molecular weight of 309.39 g/mol, XLogP of 4.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,4-dimethylphenyl)furo[3,2-b][1,4]benzothiazine 4-oxide is sourced from PubChem (CID 59572577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).