About 7-methyl-2,3-dihydrothieno[3,2-b]pyridine
7-methyl-2,3-dihydrothieno[3,2-b]pyridine (PubChem CID 59572692) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrothieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydrothieno[3,2-b]pyridine |
| PubChem CID | 59572692 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 7-methyl-2,3-dihydrothieno[3,2-b]pyridine |
| SMILES | Cc1ccnc2c1SCC2 |
| InChI | InChI=1S/C8H9NS/c1-6-2-4-9-7-3-5-10-8(6)7/h2,4H,3,5H2,1H3 |
| InChIKey | JLJLXHGLFFFWIV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2,3-dihydrothieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The IUPAC name of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine (CID 59572692) is 7-methyl-2,3-dihydrothieno[3,2-b]pyridine.
What is the SMILES notation for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The canonical SMILES for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine is Cc1ccnc2c1SCC2.
What is the InChIKey of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The InChIKey is JLJLXHGLFFFWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c1-6-2-4-9-7-3-5-10-8(6)7/h2,4H,3,5H2,1H3.
What are the key properties of 7-methyl-2,3-dihydrothieno[3,2-b]pyridine?
7-methyl-2,3-dihydrothieno[3,2-b]pyridine has a molecular weight of 151.23 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydrothieno[3,2-b]pyridine is sourced from PubChem (CID 59572692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).