C18H15N3OSe — CID 59572903
2-(2-methoxyphenyl)-6-methyl-9-selena-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 59572903) has the molecular formula C18H15N3OSe and a molecular weight of 368.30 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-6-methyl-9-selena-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 2-(2-methoxyphenyl)-6-methyl-9-selena-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 59572903 |
| Molecular Formula | C18H15N3OSe |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-(2-methoxyphenyl)-6-methyl-9-selena-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | COc1ccccc1N1c2ncccc2[Se]c2cc(C)cnc21 |
| InChI | InChI=1S/C18H15N3OSe/c1-12-10-16-18(20-11-12)21(13-6-3-4-7-14(13)22-2)17-15(23-16)8-5-9-19-17/h3-11H,1-2H3 |
| InChIKey | SBKGFUWBJCIIBF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|