C26H23NO3S — CID 59572951
2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide (PubChem CID 59572951) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide.
| Compound Name | 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide |
|---|---|
| PubChem CID | 59572951 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11,11-dioxide |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)c1c(oc3ccc(C)cc13)N2c1cccc2c1CCCC2 |
| InChI | InChI=1S/C26H23NO3S/c1-16-11-13-23-20(14-16)25-26(30-23)27(21-9-5-7-18-6-3-4-8-19(18)21)22-12-10-17(2)15-24(22)31(25,28)29/h5,7,9-15H,3-4,6,8H2,1-2H3 |
| InChIKey | YGSWJRGLEBTXON-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |