C19H17N3O2S — CID 59573143
2-(2,4,6-trimethylphenyl)-9λ6-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9,9-dioxide (PubChem CID 59573143) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-9λ6-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9,9-dioxide.
| Compound Name | 2-(2,4,6-trimethylphenyl)-9λ6-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9,9-dioxide |
|---|---|
| PubChem CID | 59573143 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-9λ6-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9,9-dioxide |
| SMILES | Cc1cc(C)c(N2c3ncccc3S(=O)(=O)c3cccnc32)c(C)c1 |
| InChI | InChI=1S/C19H17N3O2S/c1-12-10-13(2)17(14(3)11-12)22-18-15(6-4-8-20-18)25(23,24)16-7-5-9-21-19(16)22/h4-11H,1-3H3 |
| InChIKey | WPNPCZKCECSFET-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |