C19H17NOS — CID 59573255
9-(2,4,6-trimethylphenyl)thieno[3,2-b][1,4]benzoxazine (PubChem CID 59573255) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is 9-(2,4,6-trimethylphenyl)thieno[3,2-b][1,4]benzoxazine.
| Compound Name | 9-(2,4,6-trimethylphenyl)thieno[3,2-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 59573255 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 9-(2,4,6-trimethylphenyl)thieno[3,2-b][1,4]benzoxazine |
| SMILES | Cc1cc(C)c(N2c3ccccc3Oc3ccsc32)c(C)c1 |
| InChI | InChI=1S/C19H17NOS/c1-12-10-13(2)18(14(3)11-12)20-15-6-4-5-7-16(15)21-17-8-9-22-19(17)20/h4-11H,1-3H3 |
| InChIKey | HVWWSLOTMDBIHX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |