C19H17N3OS — CID 59573479
2-(2,4,6-trimethylphenyl)-9λ4-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9-oxide (PubChem CID 59573479) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-9λ4-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9-oxide.
| Compound Name | 2-(2,4,6-trimethylphenyl)-9λ4-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9-oxide |
|---|---|
| PubChem CID | 59573479 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-9λ4-thia-2,4,14-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene 9-oxide |
| SMILES | Cc1cc(C)c(N2c3ncccc3S(=O)c3cccnc32)c(C)c1 |
| InChI | InChI=1S/C19H17N3OS/c1-12-10-13(2)17(14(3)11-12)22-18-15(6-4-8-20-18)24(23)16-7-5-9-21-19(16)22/h4-11H,1-3H3 |
| InChIKey | BCJKEZVXLOYICE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |