About 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one
11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one (PubChem CID 59573663) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one |
| PubChem CID | 59573663 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one |
| SMILES | Cc1ccc(N2c3ccccc3OC(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H17NO2/c1-14-11-12-17(15(2)13-14)22-18-8-4-3-7-16(18)21(23)24-20-10-6-5-9-19(20)22/h3-13H,1-2H3 |
| InChIKey | FRYZCUBMFUWQJW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one?
The IUPAC name of 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one (CID 59573663) is 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one.
What is the SMILES notation for 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one?
The canonical SMILES for 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one is Cc1ccc(N2c3ccccc3OC(=O)c3ccccc32)c(C)c1.
What is the InChIKey of 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one?
The InChIKey is FRYZCUBMFUWQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2/c1-14-11-12-17(15(2)13-14)22-18-8-4-3-7-16(18)21(23)24-20-10-6-5-9-19(20)22/h3-13H,1-2H3.
What are the key properties of 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one?
11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one has a molecular weight of 315.37 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(2,4-dimethylphenyl)benzo[c][1,5]benzoxazepin-6-one is sourced from PubChem (CID 59573663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).