C27H30Cl2O2 — CID 59573981
1,3-bis(2-chloro-4-propan-2-ylphenoxy)-5-propan-2-ylbenzene (PubChem CID 59573981) has the molecular formula C27H30Cl2O2 and a molecular weight of 457.44 g/mol. Its IUPAC name is 1,3-bis(2-chloro-4-propan-2-ylphenoxy)-5-propan-2-ylbenzene.
| Compound Name | 1,3-bis(2-chloro-4-propan-2-ylphenoxy)-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 59573981 |
| Molecular Formula | C27H30Cl2O2 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1,3-bis(2-chloro-4-propan-2-ylphenoxy)-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(Oc2ccc(C(C)C)cc2Cl)cc(Oc2ccc(C(C)C)cc2Cl)c1 |
| InChI | InChI=1S/C27H30Cl2O2/c1-16(2)19-7-9-26(24(28)13-19)30-22-11-21(18(5)6)12-23(15-22)31-27-10-8-20(17(3)4)14-25(27)29/h7-18H,1-6H3 |
| InChIKey | PQJGIXNEGGPKOI-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |