About 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane
5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 59574287) has the molecular formula C15H26S
and a molecular weight of 238.44 g/mol. Its IUPAC name is 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane |
| PubChem CID | 59574287 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CC(C)(C)CCC12CC3CC(C1)SC(C3)C2 |
| InChI | InChI=1S/C15H26S/c1-14(2,3)4-5-15-8-11-6-12(9-15)16-13(7-11)10-15/h11-13H,4-10H2,1-3H3 |
| InChIKey | ZDWSWYGMRXVNCK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane?
The IUPAC name of 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane (CID 59574287) is 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane is CC(C)(C)CCC12CC3CC(C1)SC(C3)C2.
What is the InChIKey of 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane?
The InChIKey is ZDWSWYGMRXVNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26S/c1-14(2,3)4-5-15-8-11-6-12(9-15)16-13(7-11)10-15/h11-13H,4-10H2,1-3H3.
What are the key properties of 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane?
5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane has a molecular weight of 238.44 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylbutyl)-2-thiatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 59574287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).