About ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate
ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate (PubChem CID 59574424) has the molecular formula C8H8Br2N2O3
and a molecular weight of 339.97 g/mol. Its IUPAC name is ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate |
| PubChem CID | 59574424 |
| Molecular Formula | C8H8Br2N2O3 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.89 |
| IUPAC Name | ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1ncc(Br)c(Br)c1=O |
| InChI | InChI=1S/C8H8Br2N2O3/c1-2-15-6(13)4-12-8(14)7(10)5(9)3-11-12/h3H,2,4H2,1H3 |
| InChIKey | YRLCKKYXXPLBHI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate?
The IUPAC name of ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate (CID 59574424) is ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate.
What is the SMILES notation for ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate?
The canonical SMILES for ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate is CCOC(=O)Cn1ncc(Br)c(Br)c1=O.
What is the InChIKey of ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate?
The InChIKey is YRLCKKYXXPLBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2N2O3/c1-2-15-6(13)4-12-8(14)7(10)5(9)3-11-12/h3H,2,4H2,1H3.
What are the key properties of ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate?
ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate has a molecular weight of 339.97 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-dibromo-6-oxopyridazin-1-yl)acetate is sourced from PubChem (CID 59574424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).