C14H25N — CID 59574558
(1S,5R)-N-tert-butyl-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-amine (PubChem CID 59574558) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (1S,5R)-N-tert-butyl-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-amine.
| Compound Name | (1S,5R)-N-tert-butyl-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-amine |
|---|---|
| PubChem CID | 59574558 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (1S,5R)-N-tert-butyl-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-amine |
| SMILES | CC1=CC[C@H]2C(NC(C)(C)C)[C@@H]1C2(C)C |
| InChI | InChI=1S/C14H25N/c1-9-7-8-10-12(15-13(2,3)4)11(9)14(10,5)6/h7,10-12,15H,8H2,1-6H3/t10-,11+,12?/m0/s1 |
| InChIKey | MASFKHQPXOQQSF-WIKAKEFZSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|