C30H42BrN3O3 — CID 59574817
4-bromo-2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574817) has the molecular formula C30H42BrN3O3 and a molecular weight of 572.59 g/mol. Its IUPAC name is 4-bromo-2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574817 |
| Molecular Formula | C30H42BrN3O3 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 4-bromo-2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@H]1[C@H](Nc2cnn(CC(=O)c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C30H42BrN3O3/c1-16-19-12-18(30(19,8)9)13-22(16)33-23-14-32-34(27(37)25(23)31)15-24(35)17-10-20(28(2,3)4)26(36)21(11-17)29(5,6)7/h10-11,14,16,18-19,22,33,36H,12-13,15H2,1-9H3/t16-,18-,19+,22-/m1/s1 |
| InChIKey | BGNFGQOHZHHYAK-NSAZKJPHSA-N |
| XLogP | 6.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |