C30F12N6 — CID 59575031
4-[[2,3-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 59575031) has the molecular formula C30F12N6 and a molecular weight of 672.35 g/mol. Its IUPAC name is 4-[[2,3-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[[2,3-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 59575031 |
| Molecular Formula | C30F12N6 |
| Molecular Weight | 672.35 g/mol |
| Exact Mass | 672.00 |
| IUPAC Name | 4-[[2,3-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#CC(=C1C(=C(C#N)c2c(F)c(F)c(C#N)c(F)c2F)C1=C(C#N)c1c(F)c(F)c(C#N)c(F)c1F)c1c(F)c(F)c(C#N)c(F)c1F |
| InChI | InChI=1S/C30F12N6/c31-19-10(4-46)20(32)26(38)16(25(19)37)7(1-43)13-14(8(2-44)17-27(39)21(33)11(5-47)22(34)28(17)40)15(13)9(3-45)18-29(41)23(35)12(6-48)24(36)30(18)42/b13-7-,14-8+,15-9- |
| InChIKey | PUGLQYLNHVYWST-NNTIMSFMSA-N |
| XLogP | 7.22 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.35 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|