About dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine)
dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) (PubChem CID 59575068) has the molecular formula C24H24Cl2N4O4Os
and a molecular weight of 693.62 g/mol. Its IUPAC name is dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine).
Molecular Properties
| Compound Name | dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) |
| PubChem CID | 59575068 |
| Molecular Formula | C24H24Cl2N4O4Os |
| Molecular Weight | 693.62 g/mol |
| Exact Mass | 694.08 |
| IUPAC Name | dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) |
| SMILES | COc1ccnc(-c2cc(OC)ccn2)c1.COc1ccnc(-c2cc(OC)ccn2)c1.Cl[Os]Cl |
| InChI | InChI=1S/2C12H12N2O2.2ClH.Os/c2*1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;;;/h2*3-8H,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | YNYVCJXIHOSCNP-UHFFFAOYSA-L |
| XLogP | 5.70 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine)?
The IUPAC name of dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) (CID 59575068) is dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine).
What is the SMILES notation for dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine)?
The canonical SMILES for dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) is COc1ccnc(-c2cc(OC)ccn2)c1.COc1ccnc(-c2cc(OC)ccn2)c1.Cl[Os]Cl.
What is the InChIKey of dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine)?
The InChIKey is YNYVCJXIHOSCNP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H12N2O2.2ClH.Os/c2*1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;;;/h2*3-8H,1-2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine)?
dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) has a molecular weight of 693.62 g/mol, XLogP of 5.70, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroosmium;bis(4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine) is sourced from PubChem (CID 59575068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).