C29H32N5O11+ — CID 59576648
[5-[[amino(nitramido)methylidene]amino]-1-[[2-(furan-2-yl)-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxy]-1-oxopentan-2-yl]azanium (PubChem CID 59576648) has the molecular formula C29H32N5O11+ and a molecular weight of 626.60 g/mol. Its IUPAC name is [5-[[amino(nitramido)methylidene]amino]-1-[[2-(furan-2-yl)-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxy]-1-oxopentan-2-yl]azanium.
| Compound Name | [5-[[amino(nitramido)methylidene]amino]-1-[[2-(furan-2-yl)-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxy]-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 59576648 |
| Molecular Formula | C29H32N5O11+ |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [5-[[amino(nitramido)methylidene]amino]-1-[[2-(furan-2-yl)-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxy]-1-oxopentan-2-yl]azanium |
| SMILES | COc1cc(C(=O)c2c(-c3ccco3)oc3c(OC(=O)C([NH3+])CCC/N=C(\N)N[N+](=O)[O-])c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N5O11/c1-39-18-10-9-16-22(23(35)15-13-20(40-2)25(42-4)21(14-15)41-3)26(19-8-6-12-43-19)44-24(16)27(18)45-28(36)17(30)7-5-11-32-29(31)33-34(37)38/h6,8-10,12-14,17H,5,7,11,30H2,1-4H3,(H3,31,32,33)/p+1 |
| InChIKey | QBNJIHBNHLLFNZ-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 227.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|