C23H21N2O10P-2 — CID 59576652
[6-methoxy-2-(1-methylpyrazol-4-yl)-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate (PubChem CID 59576652) has the molecular formula C23H21N2O10P-2 and a molecular weight of 516.40 g/mol. Its IUPAC name is [6-methoxy-2-(1-methylpyrazol-4-yl)-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate.
| Compound Name | [6-methoxy-2-(1-methylpyrazol-4-yl)-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate |
|---|---|
| PubChem CID | 59576652 |
| Molecular Formula | C23H21N2O10P-2 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [6-methoxy-2-(1-methylpyrazol-4-yl)-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl] phosphate |
| SMILES | COc1cc(C(=O)c2c(-c3cnn(C)c3)oc3c(OP(=O)([O-])[O-])c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H23N2O10P/c1-25-11-13(10-24-25)20-18(19(26)12-8-16(31-3)22(33-5)17(9-12)32-4)14-6-7-15(30-2)23(21(14)34-20)35-36(27,28)29/h6-11H,1-5H3,(H2,27,28,29)/p-2 |
| InChIKey | CJEZSORXHLMLCW-UHFFFAOYSA-L |
| XLogP | 2.31 |
| TPSA | 157.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|