C25H29N5O2 — CID 59576981
2-[ethyl-[1-(2-phenylacetyl)piperidin-3-yl]amino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one (PubChem CID 59576981) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[ethyl-[1-(2-phenylacetyl)piperidin-3-yl]amino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one.
| Compound Name | 2-[ethyl-[1-(2-phenylacetyl)piperidin-3-yl]amino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 59576981 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-[ethyl-[1-(2-phenylacetyl)piperidin-3-yl]amino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
| SMILES | CCN(c1nc(-c2ccncc2)cc(=O)n1C)C1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H29N5O2/c1-3-30(25-27-22(17-23(31)28(25)2)20-11-13-26-14-12-20)21-10-7-15-29(18-21)24(32)16-19-8-5-4-6-9-19/h4-6,8-9,11-14,17,21H,3,7,10,15-16,18H2,1-2H3 |
| InChIKey | FSLUSCZBHKIYJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |