C26H26N4O4S — CID 59577391
oxolan-3-yl-[2-[[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 59577391) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is oxolan-3-yl-[2-[[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | oxolan-3-yl-[2-[[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 59577391 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | oxolan-3-yl-[2-[[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(C1CCOC1)N1CC2CN(Cc3coc4cc(Oc5nc6ncccc6s5)ccc34)CC2C1 |
| InChI | InChI=1S/C26H26N4O4S/c31-25(16-5-7-32-14-16)30-12-17-9-29(10-18(17)13-30)11-19-15-33-22-8-20(3-4-21(19)22)34-26-28-24-23(35-26)2-1-6-27-24/h1-4,6,8,15-18H,5,7,9-14H2 |
| InChIKey | RSTCLMXQBAZIPP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |