About [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine
[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine (PubChem CID 59577515) has the molecular formula C15H11N3O2S
and a molecular weight of 297.34 g/mol. Its IUPAC name is [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine.
Molecular Properties
| Compound Name | [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine |
| PubChem CID | 59577515 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine |
| SMILES | NCc1coc2cc(Oc3nc4ncccc4s3)ccc12 |
| InChI | InChI=1S/C15H11N3O2S/c16-7-9-8-19-12-6-10(3-4-11(9)12)20-15-18-14-13(21-15)2-1-5-17-14/h1-6,8H,7,16H2 |
| InChIKey | SDKKIXNVWSHLJQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine?
The IUPAC name of [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine (CID 59577515) is [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine.
What is the SMILES notation for [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine?
The canonical SMILES for [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine is NCc1coc2cc(Oc3nc4ncccc4s3)ccc12.
What is the InChIKey of [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine?
The InChIKey is SDKKIXNVWSHLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2S/c16-7-9-8-19-12-6-10(3-4-11(9)12)20-15-18-14-13(21-15)2-1-5-17-14/h1-6,8H,7,16H2.
What are the key properties of [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine?
[6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine has a molecular weight of 297.34 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-3-yl]methanamine is sourced from PubChem (CID 59577515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).