About ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate
ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate (PubChem CID 59577523) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate |
| PubChem CID | 59577523 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate |
| SMILES | CCOC(=O)CN(C(C)=O)C1C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C13H22N2O3/c1-3-18-13(17)8-15(9(2)16)12-6-10-4-5-11(7-12)14-10/h10-12,14H,3-8H2,1-2H3/t10-,11+,12? |
| InChIKey | SPSQDOJYTZNASW-FOSCPWQOSA-N |
| XLogP | 0.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate?
The IUPAC name of ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate (CID 59577523) is ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate.
What is the SMILES notation for ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate?
The canonical SMILES for ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate is CCOC(=O)CN(C(C)=O)C1C[C@H]2CC[C@@H](C1)N2.
What is the InChIKey of ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate?
The InChIKey is SPSQDOJYTZNASW-FOSCPWQOSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-3-18-13(17)8-15(9(2)16)12-6-10-4-5-11(7-12)14-10/h10-12,14H,3-8H2,1-2H3/t10-,11+,12?.
What are the key properties of ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate?
ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate has a molecular weight of 254.33 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[acetyl-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]amino]acetate is sourced from PubChem (CID 59577523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).