About 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine
4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine (PubChem CID 59577582) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine |
| PubChem CID | 59577582 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine |
| SMILES | c1ccc2sc(Oc3ccc4c(CN5CCOCC5)coc4c3)nc2c1 |
| InChI | InChI=1S/C20H18N2O3S/c1-2-4-19-17(3-1)21-20(26-19)25-15-5-6-16-14(13-24-18(16)11-15)12-22-7-9-23-10-8-22/h1-6,11,13H,7-10,12H2 |
| InChIKey | NHQCIXXCPKITFT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine?
The IUPAC name of 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine (CID 59577582) is 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine.
What is the SMILES notation for 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine?
The canonical SMILES for 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine is c1ccc2sc(Oc3ccc4c(CN5CCOCC5)coc4c3)nc2c1.
What is the InChIKey of 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine?
The InChIKey is NHQCIXXCPKITFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3S/c1-2-4-19-17(3-1)21-20(26-19)25-15-5-6-16-14(13-24-18(16)11-15)12-22-7-9-23-10-8-22/h1-6,11,13H,7-10,12H2.
What are the key properties of 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine?
4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine has a molecular weight of 366.44 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(1,3-benzothiazol-2-yloxy)-1-benzofuran-3-yl]methyl]morpholine is sourced from PubChem (CID 59577582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).