C13H12ClN3O — CID 59577848
8-chloro-2-pyridin-3-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine (PubChem CID 59577848) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is 8-chloro-2-pyridin-3-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine.
| Compound Name | 8-chloro-2-pyridin-3-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine |
|---|---|
| PubChem CID | 59577848 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 8-chloro-2-pyridin-3-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine |
| SMILES | Clc1ccc2c(n1)OC(c1cccnc1)CNC2 |
| InChI | InChI=1S/C13H12ClN3O/c14-12-4-3-10-7-16-8-11(18-13(10)17-12)9-2-1-5-15-6-9/h1-6,11,16H,7-8H2 |
| InChIKey | PLKUXQXFMWNQGB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|