C30H47ClO6Si2 — CID 59578208
(4R,6S,8R,11E)-17,19-bis[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione (PubChem CID 59578208) has the molecular formula C30H47ClO6Si2 and a molecular weight of 595.33 g/mol. Its IUPAC name is (4R,6S,8R,11E)-17,19-bis[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione.
| Compound Name | (4R,6S,8R,11E)-17,19-bis[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
|---|---|
| PubChem CID | 59578208 |
| Molecular Formula | C30H47ClO6Si2 |
| Molecular Weight | 595.33 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | (4R,6S,8R,11E)-17,19-bis[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]2CC/C=C/C(=O)Cc2c(Cl)c(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2C(=O)O1 |
| InChI | InChI=1S/C30H47ClO6Si2/c1-19-16-23-22(35-23)15-13-12-14-20(32)17-21-26(28(33)34-19)24(36-38(8,9)29(2,3)4)18-25(27(21)31)37-39(10,11)30(5,6)7/h12,14,18-19,22-23H,13,15-17H2,1-11H3/b14-12+/t19-,22-,23+/m1/s1 |
| InChIKey | NGYMWMAKXZIOJG-ZOIZZCPQSA-N |
| XLogP | 8.27 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.33 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|