C25H25ClO3 — CID 59578213
(4R,6E,10E)-15-chloro-16,18-dimethyl-4-phenyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 59578213) has the molecular formula C25H25ClO3 and a molecular weight of 408.93 g/mol. Its IUPAC name is (4R,6E,10E)-15-chloro-16,18-dimethyl-4-phenyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | (4R,6E,10E)-15-chloro-16,18-dimethyl-4-phenyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 59578213 |
| Molecular Formula | C25H25ClO3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (4R,6E,10E)-15-chloro-16,18-dimethyl-4-phenyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | Cc1cc(C)c2c(c1Cl)CC(=O)/C=C/CC/C=C/C[C@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C25H25ClO3/c1-17-15-18(2)24(26)21-16-20(27)13-9-4-3-5-10-14-22(29-25(28)23(17)21)19-11-7-6-8-12-19/h5-13,15,22H,3-4,14,16H2,1-2H3/b10-5+,13-9+/t22-/m1/s1 |
| InChIKey | QQXGNAZJYFFAKD-XYUMISKTSA-N |
| XLogP | 6.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|